Wednesday, August 31, 2022

Draw The Structure For 2 Bromo 3 Methyl 3 Heptanol


Draw The Structure For 2 Bromo 3 Methyl 3 Heptanol

gambarkan struktur alkanol yang namanya:a) 2,2 dimetil 1-pentanolb) 3-etil 2,3,4 trimetil 2-heptanolc) 3,4 dietil 2,2-dimetil 3-heptanold) 3-kloro 2,2-dimetil 3-oktanole) 3,4 dietil 2-metil 3-heptanolf) 4-bromo 2,3 dimetil 2- pentanol

Daftar Isi

1. gambarkan struktur alkanol yang namanya:a) 2,2 dimetil 1-pentanolb) 3-etil 2,3,4 trimetil 2-heptanolc) 3,4 dietil 2,2-dimetil 3-heptanold) 3-kloro 2,2-dimetil 3-oktanole) 3,4 dietil 2-metil 3-heptanolf) 4-bromo 2,3 dimetil 2- pentanol


struktur senyawa di atas

2. gambarkan struktur alkanol yang namanya:a) 3,4 dietil 2-metil 3-heptanolb) 4-bromo 2,3 dimetil 2-pentanol


jawabannya di gambar

3. Draw the Lewis structure of 8O and 8O​


Jawaban:

https://press.rebus.community/introductorychemistry/chapter/lewis-dot-symbols-and-lewis-structures-writing-lewis-symbols-for-atoms/


4. for each of the following, give the structural formula and the molecular formula.... A. CH3 CH2 CH3 B. CH3 CH2 CH(CH3) CH3 C. C2H6 D. Octana E. 3-ethyl-pentane F. 3-methyl-hexane


kalo structural formula, itu maksudnya ada gambar bentuk molekul dengan ikatan tangan-tangan...
kalo molecular formula, itu maksudnya adalah bentuk paling riskas dari sebuah molekul.

saya bantu untuk molecular formulanya dulu...
a. C3H8
b. C5H12
c. C2H6
d. OCtane ya? C8H18
e. C7H16
f. C7H16

kalo yang structural formula, begini: (kalo C H g ada tanganya sambung dg tangan... mks)
a.
   H H H
H-C-C-C-H
   H H H

b.
   H H H H H
H-C-C-C-C-C-H
   H H H H H

c.
   H H 
H-C-C-H
   H H 

d.
   H H H H H H H H
H-C-C-C-C-C-C-C-C-H
   H H H H H H H H

e.
         H
      H-C-H
          I
      H-C-H
   H H  I   H H
H-C-C-C-C-C-H
   H H H H H

f.
          H
       H-C-H
   H H  I  H H H
H-C-C-C-C-C-C-H
   H H H H H H



5. Gambarkan struktur dari 2-etil 3-metil 1-heptanol


Rantai induk Hepta = 7 atom C

Pada

No. 1 ada OH

No. 2 ada C2H5

No. 3 ada CH3


6. rumus stuktur 3 heptanol


CH3 - CH2 - CH (OH) - CH2 - CH2 - CH2 - CH3

7. Oksidasi 3 metil 2 heptanol dengan asam kromat menghasilkan


2-heptanol merupakan gugus alkohol sekunder, jika dioksidasi menghasilkan gugus keton.

3-metil-2-heptanol + On --->
3-metil-2-heptanon

#ChemistryIsFun

8. Oksidasi 3-metil-2-heptanol dengan asam kromat menghasilkan


Materi : Kimia Organik
Sub materi : Alkanol

Asam kromat disini bertindak sbg oksidator, dgn mengoksidasi gugus alkohol.

2-heptanol merupakan gugus alkohol sekunder shg dioksidasi menjadi gugus keton.

Senyawa yg terbentuk:
3-metil-2-heptanon

#ChemistryIsFun

9. Tuliskan gambar struktur dari 2 etil 3 metil 4 heptanol​


<p>semoga jawaban membantu </p>


10. draw the clock3:25jam berapa ​


Semoga membantub yaaa

11. Hasil adisi HBr terhadap 2-metil-2-butena adalah? A. 1-bromo-3-metilbutana B. 3-bromo-2-metilbutana C. 2-bromo-2metilbutana D. 2-bromo-3-metilbutana E. 3-bromo-2-metilbutana


Menurut aturan Markovnikov jawabannya 2-bromo-2-metil butana

12. draw structure trees use word : 1. aware of the problem2. see the answer3. a surly passenger insulted the attendant4. the blue guitar sold for a song5. John deposited some money in the bank6. Tom offered advice to his students.​


Jawaban:

menggambar pohon struktur menggunakan kata: 1. menyadari masalah

2. lihat jawabannya

3. penumpang yang bermuka masam menghina petugas

4. gitar biru dijual untuk sebuah lagu

5. John menyimpan sejumlah uang di bank

6. Tom menawarkan nasihat kepada murid-muridnya

Penjelasan:

Sorryklosalah__


13. Tuliskan struktur molekul dari nama : A. 2,3-dietil -3-metil -1-heptanol B. 3-etil -2-heptanol


C2H5
A. CH3|-CH2|-CH2|-CH2-CH2-CH2-CH3
OH. C2H5. CH3Lihat digambar ya....

14. 1.Look for an example of narrative text 2. Determine the type of Generic structure! 3. Write the Moral Value of the text.


1)Here's an example of a narrative sentence: It was a time where a knight heard about the contest to fight for the king's daughter.

2)Types of Generic Structures From an Expert's Point of View Narrative discourse groups. Argumentative discourse group.

3)We get moral values in the form of narrative sentences, structures and others.


15. Hasil adisi HBr terhadap 2-metil-2 -butena adalah…. a. 2- bromo -2-metil butana b. 3- bromo -2-metil butana c. 3- bromo -3-metil butana d. 2- metil- 3- bromo butana e. 2- bromo -2- metil butane


a. 2 bromo 2 metil butana

16. 1.Alexis and husband always.....(come) for the summer 2........(he draw) well? 3. James......(not remember)me


Jawaban:

1. Come

2. Does he draw

3. Does't remember

Semoga Membantu

1. Come

2. Does he draw

3. Doesn’t remember

Penjelasan:

1. Subject kalimat nomor 1 adalah Alexis and Husband (They, karena lebih dari 1 orang) maka kata kerja bentuk kesatu tanpa tambahan 's/es'.

2. Rumus kalimat interogatif (kalimat tanya) pada Simple Present Tense adalah :

Does + He/She/It + V1 + O?

3. Rumus kalimat negatif pada Simple Present Tense adalah :

S (He/She/It) + Does + Not + V1 + O


17. 3. Write the structure of the text !


Jawaban:

tulis struktur kata pada teks

Penjelasan:

yg itu artinya saya paham, maaf klo salah


18. Hasil adisi HBr terhadap 2-metil-2 -butena adalah…. a. 2- bromo -2-metil butana b. 3- bromo -2-metil butana c. 3- bromo -3-metil butana d. 2- metil- 3- bromo butana e. 2- bromo -2- metil butane


Kategori Soal: Kimia - Kimia Organik/Reaksi Adisi
Kelas: 3 SMA/ XII

Pembahasan
                                                              Br
                                                               I
CH₃ - C = CH - CH₃ + HBr →     CH₃ - C - CH - CH₃           +         ¹/₂ H₂
            I                                                  I
          CH₃                                          CH₃

   2-metil-2-butena                      2-bromo-2-metil butana

19. draw the graph y = x ² - x - 5 for -3 ≤ x ≤ 4 and find its turning point​


Jawab:

[tex](X,Y)= (-0.5 , - 4.75)[/tex]

Penjelasan dengan langkah-langkah:

Graph:

(attached)

Turning point:

[tex]x =\frac{-b}{2a}[/tex]

[tex]x=\frac{1}{2(1)}[/tex]

[tex]x=\frac{1}{2}[/tex]

Once X is found, substitute the x in the equation with 1/2

[tex]y=(\frac{1}{2}) ^{2} - (\frac{1}{2}) - 5[/tex]

[tex]y=0.25+0.5-5\\y=-5.25[/tex]

Turning Point:

[tex](X,Y)= (0.5 , - 5.25)[/tex]


20. Tulis struktur senyawa 4-etil-3-metil-2-heptanol


Ch3ch2(oH)ch(ch3)ch(c2h5)ch2ch2ch3


Video Terkait Topik Diatas


0 Comments:

Post a Comment